C19H33BrIN5 — CID 111275734
1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111275734) has the molecular formula C19H33BrIN5 and a molecular weight of 538.32 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111275734 |
| Molecular Formula | C19H33BrIN5 |
| Molecular Weight | 538.32 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-[3-(4-methyl-1,4-diazepan-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCN1CCCN(C)CC1)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C19H32BrN5.HI/c1-21-19(24(3)16-17-8-4-5-9-18(17)20)22-10-6-12-25-13-7-11-23(2)14-15-25;/h4-5,8-9H,6-7,10-16H2,1-3H3,(H,21,22);1H |
| InChIKey | XMZMHAYXLPBXEX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|