C16H25BrN4O2S — CID 111275787
1-[(2-bromophenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine (PubChem CID 111275787) has the molecular formula C16H25BrN4O2S and a molecular weight of 417.37 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275787 |
| Molecular Formula | C16H25BrN4O2S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCCN1CCS(=O)(=O)CC1)N(C)Cc1ccccc1Br |
| InChI | InChI=1S/C16H25BrN4O2S/c1-18-16(20(2)13-14-5-3-4-6-15(14)17)19-7-8-21-9-11-24(22,23)12-10-21/h3-6H,7-13H2,1-2H3,(H,18,19) |
| InChIKey | HXPWPTPOWWDWJQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|