C20H35ClIN5 — CID 111294744
1-[(2-chlorophenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine;hydroiodide (PubChem CID 111294744) has the molecular formula C20H35ClIN5 and a molecular weight of 507.89 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 1-[(2-chlorophenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111294744 |
| Molecular Formula | C20H35ClIN5 |
| Molecular Weight | 507.89 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[(2-chlorophenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine;hydroiodide |
| SMILES | CCN1CCN(CCCCN/C(=N/C)N(C)Cc2ccccc2Cl)CC1.I |
| InChI | InChI=1S/C20H34ClN5.HI/c1-4-25-13-15-26(16-14-25)12-8-7-11-23-20(22-2)24(3)17-18-9-5-6-10-19(18)21;/h5-6,9-10H,4,7-8,11-17H2,1-3H3,(H,22,23);1H |
| InChIKey | UHVKGICUQHBJEA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.89 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|