C22H39N5O — CID 111275109
1-[(4-ethoxyphenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine (PubChem CID 111275109) has the molecular formula C22H39N5O and a molecular weight of 389.59 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275109 |
| Molecular Formula | C22H39N5O |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.32 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethylguanidine |
| SMILES | CCOc1ccc(CN(C)/C(=N/C)NCCCCN2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C22H39N5O/c1-5-26-15-17-27(18-16-26)14-8-7-13-24-22(23-3)25(4)19-20-9-11-21(12-10-20)28-6-2/h9-12H,5-8,13-19H2,1-4H3,(H,23,24) |
| InChIKey | NSZJSLAPMRFEGZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|