C21H38IN5O — CID 111273744
3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide (PubChem CID 111273744) has the molecular formula C21H38IN5O and a molecular weight of 503.47 g/mol. Its IUPAC name is 3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide.
| Compound Name | 3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111273744 |
| Molecular Formula | C21H38IN5O |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-[4-(4-ethylpiperazin-1-yl)butyl]-1,2-dimethyl-1-(2-phenoxyethyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(CCCCN/C(=N/C)N(C)CCOc2ccccc2)CC1.I |
| InChI | InChI=1S/C21H37N5O.HI/c1-4-25-14-16-26(17-15-25)13-9-8-12-23-21(22-2)24(3)18-19-27-20-10-6-5-7-11-20;/h5-7,10-11H,4,8-9,12-19H2,1-3H3,(H,22,23);1H |
| InChIKey | JJBXGVCEDRNYED-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|