C21H37N5O — CID 111275099
1-[(4-ethoxyphenyl)methyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine (PubChem CID 111275099) has the molecular formula C21H37N5O and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-[(4-ethoxyphenyl)methyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(4-ethoxyphenyl)methyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111275099 |
| Molecular Formula | C21H37N5O |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.30 |
| IUPAC Name | 1-[(4-ethoxyphenyl)methyl]-3-[2-(4-ethylpiperazin-1-yl)propyl]-1,2-dimethylguanidine |
| SMILES | CCOc1ccc(CN(C)/C(=N\C)NCC(C)N2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C21H37N5O/c1-6-25-12-14-26(15-13-25)18(3)16-23-21(22-4)24(5)17-19-8-10-20(11-9-19)27-7-2/h8-11,18H,6-7,12-17H2,1-5H3,(H,22,23) |
| InChIKey | HWAQPMSJYKUJPM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|