C21H34F3N5 — CID 111299873
3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine (PubChem CID 111299873) has the molecular formula C21H34F3N5 and a molecular weight of 413.53 g/mol. Its IUPAC name is 3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine.
| Compound Name | 3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111299873 |
| Molecular Formula | C21H34F3N5 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.28 |
| IUPAC Name | 3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethyl-1-[[4-(trifluoromethyl)phenyl]methyl]guanidine |
| SMILES | CCN1CCN(CC(C)CN/C(=N\C)N(C)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H34F3N5/c1-5-28-10-12-29(13-11-28)15-17(2)14-26-20(25-3)27(4)16-18-6-8-19(9-7-18)21(22,23)24/h6-9,17H,5,10-16H2,1-4H3,(H,25,26) |
| InChIKey | YDGRITSQKOROKT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|