C20H34BrN5 — CID 111276007
1-[(2-bromophenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine (PubChem CID 111276007) has the molecular formula C20H34BrN5 and a molecular weight of 424.43 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2-bromophenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111276007 |
| Molecular Formula | C20H34BrN5 |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-3-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1,2-dimethylguanidine |
| SMILES | CCN1CCN(CC(C)CN/C(=N/C)N(C)Cc2ccccc2Br)CC1 |
| InChI | InChI=1S/C20H34BrN5/c1-5-25-10-12-26(13-11-25)15-17(2)14-23-20(22-3)24(4)16-18-8-6-7-9-19(18)21/h6-9,17H,5,10-16H2,1-4H3,(H,22,23) |
| InChIKey | RZVGVDOMRKJYEQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|