C13H18BrF3IN3O — CID 119131389
1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide (PubChem CID 119131389) has the molecular formula C13H18BrF3IN3O and a molecular weight of 496.11 g/mol. Its IUPAC name is 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide.
| Compound Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119131389 |
| Molecular Formula | C13H18BrF3IN3O |
| Molecular Weight | 496.11 g/mol |
| Exact Mass | 494.96 |
| IUPAC Name | 1-[(2-bromophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)N(C)Cc1ccccc1Br.I |
| InChI | InChI=1S/C13H17BrF3N3O.HI/c1-18-12(19-7-11(21)13(15,16)17)20(2)8-9-5-3-4-6-10(9)14;/h3-6,11,21H,7-8H2,1-2H3,(H,18,19);1H |
| InChIKey | OQSIIUQXLUBORM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.11 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|