C13H17ClF3N3O — CID 119132004
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine (PubChem CID 119132004) has the molecular formula C13H17ClF3N3O and a molecular weight of 323.75 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
|---|---|
| PubChem CID | 119132004 |
| Molecular Formula | C13H17ClF3N3O |
| Molecular Weight | 323.75 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-(3,3,3-trifluoro-2-hydroxypropyl)guanidine |
| SMILES | C/N=C(\NCC(O)C(F)(F)F)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClF3N3O/c1-18-12(19-7-11(21)13(15,16)17)20(2)8-9-4-3-5-10(14)6-9/h3-6,11,21H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | JFUIZGXPMVTOHI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|