C13H17ClIN3 — CID 111305522
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-ynylguanidine;hydroiodide (PubChem CID 111305522) has the molecular formula C13H17ClIN3 and a molecular weight of 377.66 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-ynylguanidine;hydroiodide.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-ynylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111305522 |
| Molecular Formula | C13H17ClIN3 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-ynylguanidine;hydroiodide |
| SMILES | C#CCN/C(=N\C)N(C)Cc1cccc(Cl)c1.I |
| InChI | InChI=1S/C13H16ClN3.HI/c1-4-8-16-13(15-2)17(3)10-11-6-5-7-12(14)9-11;/h1,5-7,9H,8,10H2,2-3H3,(H,15,16);1H |
| InChIKey | IRBILFXNFSPARN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|