C13H18ClN3 — CID 111305491
1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-enylguanidine (PubChem CID 111305491) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-enylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111305491 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-1,2-dimethyl-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\C)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3/c1-4-8-16-13(15-2)17(3)10-11-6-5-7-12(14)9-11/h4-7,9H,1,8,10H2,2-3H3,(H,15,16) |
| InChIKey | GMNMFMRWSRMQIF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|