C16H27ClN4O — CID 111305205
1-[(3-chlorophenyl)methyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-1,2-dimethylguanidine (PubChem CID 111305205) has the molecular formula C16H27ClN4O and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111305205 |
| Molecular Formula | C16H27ClN4O |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[2-[2-methoxyethyl(methyl)amino]ethyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCCN(C)CCOC)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H27ClN4O/c1-18-16(19-8-9-20(2)10-11-22-4)21(3)13-14-6-5-7-15(17)12-14/h5-7,12H,8-11,13H2,1-4H3,(H,18,19) |
| InChIKey | YWHYMSFWASWWPI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|