C15H23ClN4O2 — CID 111305259
2-[[N-[(3-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111305259) has the molecular formula C15H23ClN4O2 and a molecular weight of 326.83 g/mol. Its IUPAC name is 2-[[N-[(3-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[N-[(3-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111305259 |
| Molecular Formula | C15H23ClN4O2 |
| Molecular Weight | 326.83 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[[N-[(3-chlorophenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H23ClN4O2/c1-17-15(19-10-14(21)18-7-8-22-3)20(2)11-12-5-4-6-13(16)9-12/h4-6,9H,7-8,10-11H2,1-3H3,(H,17,19)(H,18,21) |
| InChIKey | YABOMEATLDGYJO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.83 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|