C18H29ClIN5O2 — CID 111357423
2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111357423) has the molecular formula C18H29ClIN5O2 and a molecular weight of 509.82 g/mol. Its IUPAC name is 2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111357423 |
| Molecular Formula | C18H29ClIN5O2 |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.11 |
| IUPAC Name | 2-[[C-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N1CCN(Cc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C18H28ClN5O2.HI/c1-20-18(22-13-17(25)21-6-11-26-2)24-9-7-23(8-10-24)14-15-4-3-5-16(19)12-15;/h3-5,12H,6-11,13-14H2,1-2H3,(H,20,22)(H,21,25);1H |
| InChIKey | IFGBKEZFOADPQD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|