C20H34IN5O4 — CID 111303042
2-[[C-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111303042) has the molecular formula C20H34IN5O4 and a molecular weight of 535.43 g/mol. Its IUPAC name is 2-[[C-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[C-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111303042 |
| Molecular Formula | C20H34IN5O4 |
| Molecular Weight | 535.43 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | 2-[[C-[4-[(2,5-dimethoxyphenyl)methyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N1CCN(Cc2cc(OC)ccc2OC)CC1.I |
| InChI | InChI=1S/C20H33N5O4.HI/c1-21-20(23-14-19(26)22-7-12-27-2)25-10-8-24(9-11-25)15-16-13-17(28-3)5-6-18(16)29-4;/h5-6,13H,7-12,14-15H2,1-4H3,(H,21,23)(H,22,26);1H |
| InChIKey | BNOFJTMHQBFNHI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.43 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|