C20H33N5O4S — CID 111303209
4-[(2,5-dimethoxyphenyl)methyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111303209) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303209 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCCN1CCCS1(=O)=O)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C20H33N5O4S/c1-21-20(22-7-9-25-8-4-14-30(25,26)27)24-12-10-23(11-13-24)16-17-15-18(28-2)5-6-19(17)29-3/h5-6,15H,4,7-14,16H2,1-3H3,(H,21,22) |
| InChIKey | ABGVMHKMRVPEBN-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|