C19H34IN5O4S — CID 111303544
4-[(2,5-dimethoxyphenyl)methyl]-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111303544) has the molecular formula C19H34IN5O4S and a molecular weight of 555.48 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111303544 |
| Molecular Formula | C19H34IN5O4S |
| Molecular Weight | 555.48 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[3-(methanesulfonamido)propyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCCCNS(C)(=O)=O)N1CCN(Cc2cc(OC)ccc2OC)CC1.I |
| InChI | InChI=1S/C19H33N5O4S.HI/c1-20-19(21-8-5-9-22-29(4,25)26)24-12-10-23(11-13-24)15-16-14-17(27-2)6-7-18(16)28-3;/h6-7,14,22H,5,8-13,15H2,1-4H3,(H,20,21);1H |
| InChIKey | QXOKGIUHUCUGIZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.48 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|