C20H32N4O4S — CID 111303527
4-[(2,5-dimethoxyphenyl)methyl]-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111303527) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is 4-[(2,5-dimethoxyphenyl)methyl]-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111303527 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 4-[(2,5-dimethoxyphenyl)methyl]-N-[(1,1-dioxothiolan-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)N1CCN(Cc2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-21-20(22-13-16-6-11-29(25,26)15-16)24-9-7-23(8-10-24)14-17-12-18(27-2)4-5-19(17)28-3/h4-5,12,16H,6-11,13-15H2,1-3H3,(H,21,22) |
| InChIKey | WDCDXEAMNSDKME-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|