C18H28IN3O3S — CID 111731568
N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111731568) has the molecular formula C18H28IN3O3S and a molecular weight of 493.41 g/mol. Its IUPAC name is N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111731568 |
| Molecular Formula | C18H28IN3O3S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[(1,1-dioxothiolan-3-yl)methyl]-3-(4-methoxyphenyl)-N'-methylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCS(=O)(=O)C1)N1CCC(c2ccc(OC)cc2)C1.I |
| InChI | InChI=1S/C18H27N3O3S.HI/c1-19-18(20-11-14-8-10-25(22,23)13-14)21-9-7-16(12-21)15-3-5-17(24-2)6-4-15;/h3-6,14,16H,7-13H2,1-2H3,(H,19,20);1H |
| InChIKey | MITHTUSBHXTBHC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|