C19H30ClN5O3 — CID 111363421
2-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111363421) has the molecular formula C19H30ClN5O3 and a molecular weight of 411.93 g/mol. Its IUPAC name is 2-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111363421 |
| Molecular Formula | C19H30ClN5O3 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | 2-[[C-[4-[2-(4-chlorophenoxy)ethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)NCCOC)N1CCN(CCOc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H30ClN5O3/c1-21-19(23-15-18(26)22-7-13-27-2)25-10-8-24(9-11-25)12-14-28-17-5-3-16(20)4-6-17/h3-6H,7-15H2,1-2H3,(H,21,23)(H,22,26) |
| InChIKey | QEKDTGNIXFABRG-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|