C19H31ClIN5O2 — CID 111357447
2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111357447) has the molecular formula C19H31ClIN5O2 and a molecular weight of 523.85 g/mol. Its IUPAC name is 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111357447 |
| Molecular Formula | C19H31ClIN5O2 |
| Molecular Weight | 523.85 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-[[[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-(ethylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCCOC)N1CCN(Cc2cccc(Cl)c2)CC1.I |
| InChI | InChI=1S/C19H30ClN5O2.HI/c1-3-21-19(23-14-18(26)22-7-12-27-2)25-10-8-24(9-11-25)15-16-5-4-6-17(20)13-16;/h4-6,13H,3,7-12,14-15H2,1-2H3,(H,21,23)(H,22,26);1H |
| InChIKey | IFZFDGHCNFZCQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.85 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|