C24H34IN5O2 — CID 110959630
2-[[(4-benzylpiperazin-1-yl)-(ethylamino)methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 110959630) has the molecular formula C24H34IN5O2 and a molecular weight of 551.47 g/mol. Its IUPAC name is 2-[[(4-benzylpiperazin-1-yl)-(ethylamino)methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[(4-benzylpiperazin-1-yl)-(ethylamino)methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 110959630 |
| Molecular Formula | C24H34IN5O2 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 2-[[(4-benzylpiperazin-1-yl)-(ethylamino)methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)N1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C24H33N5O2.HI/c1-3-25-24(27-18-23(30)26-17-20-9-11-22(31-2)12-10-20)29-15-13-28(14-16-29)19-21-7-5-4-6-8-21;/h4-12H,3,13-19H2,1-2H3,(H,25,27)(H,26,30);1H |
| InChIKey | NTPZDJGZGYDFBH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|