C24H34IN5O3 — CID 111290890
2-[[ethylamino-[4-(3-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide (PubChem CID 111290890) has the molecular formula C24H34IN5O3 and a molecular weight of 567.47 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(3-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[4-(3-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111290890 |
| Molecular Formula | C24H34IN5O3 |
| Molecular Weight | 567.47 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 2-[[ethylamino-[4-(3-methoxyphenyl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C24H33N5O3.HI/c1-4-25-24(27-18-23(30)26-17-19-8-10-21(31-2)11-9-19)29-14-12-28(13-15-29)20-6-5-7-22(16-20)32-3;/h5-11,16H,4,12-15,17-18H2,1-3H3,(H,25,27)(H,26,30);1H |
| InChIKey | PDQDQZSVFBAKOB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|