C20H32IN5O4 — CID 111164794
ethyl 4-[N-ethyl-N'-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164794) has the molecular formula C20H32IN5O4 and a molecular weight of 533.41 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164794 |
| Molecular Formula | C20H32IN5O4 |
| Molecular Weight | 533.41 g/mol |
| Exact Mass | 533.15 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-[(4-methoxyphenyl)methylamino]-2-oxoethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C20H31N5O4.HI/c1-4-21-19(24-10-12-25(13-11-24)20(27)29-5-2)23-15-18(26)22-14-16-6-8-17(28-3)9-7-16;/h6-9H,4-5,10-15H2,1-3H3,(H,21,23)(H,22,26);1H |
| InChIKey | AWHLEXQNYVYRHS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|