C20H30F3N5O2 — CID 109377813
2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 109377813) has the molecular formula C20H30F3N5O2 and a molecular weight of 429.49 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 109377813 |
| Molecular Formula | C20H30F3N5O2 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C20H30F3N5O2/c1-4-24-19(28-11-9-27(10-12-28)15(2)20(21,22)23)26-14-18(29)25-13-16-5-7-17(30-3)8-6-16/h5-8,15H,4,9-14H2,1-3H3,(H,24,26)(H,25,29) |
| InChIKey | QODDZEZIFPWIIL-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|