C18H25F4N5O — CID 109376405
2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(3-fluorophenyl)acetamide (PubChem CID 109376405) has the molecular formula C18H25F4N5O and a molecular weight of 403.42 g/mol. Its IUPAC name is 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 109376405 |
| Molecular Formula | C18H25F4N5O |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]-N-(3-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H25F4N5O/c1-3-23-17(24-12-16(28)25-15-6-4-5-14(19)11-15)27-9-7-26(8-10-27)13(2)18(20,21)22/h4-6,11,13H,3,7-10,12H2,1-2H3,(H,23,24)(H,25,28) |
| InChIKey | BNGCEWPTKWIDPS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|