C19H27FN4O3 — CID 110993807
ethyl 1-[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperidine-3-carboxylate (PubChem CID 110993807) has the molecular formula C19H27FN4O3 and a molecular weight of 378.45 g/mol. Its IUPAC name is ethyl 1-[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110993807 |
| Molecular Formula | C19H27FN4O3 |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | ethyl 1-[N-ethyl-N'-[2-(3-fluoroanilino)-2-oxoethyl]carbamimidoyl]piperidine-3-carboxylate |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)N1CCCC(C(=O)OCC)C1 |
| InChI | InChI=1S/C19H27FN4O3/c1-3-21-19(24-10-6-7-14(13-24)18(26)27-4-2)22-12-17(25)23-16-9-5-8-15(20)11-16/h5,8-9,11,14H,3-4,6-7,10,12-13H2,1-2H3,(H,21,22)(H,23,25) |
| InChIKey | UIXMYGFKFCCXOH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|