C19H29FIN5O2 — CID 111727310
2-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide (PubChem CID 111727310) has the molecular formula C19H29FIN5O2 and a molecular weight of 505.38 g/mol. Its IUPAC name is 2-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111727310 |
| Molecular Formula | C19H29FIN5O2 |
| Molecular Weight | 505.38 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 2-[[ethylamino-(3-morpholin-4-ylpyrrolidin-1-yl)methylidene]amino]-N-(3-fluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1cccc(F)c1)N1CCC(N2CCOCC2)C1.I |
| InChI | InChI=1S/C19H28FN5O2.HI/c1-2-21-19(22-13-18(26)23-16-5-3-4-15(20)12-16)25-7-6-17(14-25)24-8-10-27-11-9-24;/h3-5,12,17H,2,6-11,13-14H2,1H3,(H,21,22)(H,23,26);1H |
| InChIKey | PPKHILCPJBAWJH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|