C18H27F3IN5O — CID 109378825
3-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 109378825) has the molecular formula C18H27F3IN5O and a molecular weight of 513.35 g/mol. Its IUPAC name is 3-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | 3-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 109378825 |
| Molecular Formula | C18H27F3IN5O |
| Molecular Weight | 513.35 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 3-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(N)=O)c1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H26F3N5O.HI/c1-3-23-17(24-12-14-5-4-6-15(11-14)16(22)27)26-9-7-25(8-10-26)13(2)18(19,20)21;/h4-6,11,13H,3,7-10,12H2,1-2H3,(H2,22,27)(H,23,24);1H |
| InChIKey | JEJQFSFEHUFHTI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|