C21H29F3N6 — CID 109376865
N'-[(1-benzylpyrazol-4-yl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109376865) has the molecular formula C21H29F3N6 and a molecular weight of 422.50 g/mol. Its IUPAC name is N'-[(1-benzylpyrazol-4-yl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(1-benzylpyrazol-4-yl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109376865 |
| Molecular Formula | C21H29F3N6 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | N'-[(1-benzylpyrazol-4-yl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cnn(Cc2ccccc2)c1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H29F3N6/c1-3-25-20(29-11-9-28(10-12-29)17(2)21(22,23)24)26-13-19-14-27-30(16-19)15-18-7-5-4-6-8-18/h4-8,14,16-17H,3,9-13,15H2,1-2H3,(H,25,26) |
| InChIKey | YVMQBZRAIPRMIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|