C14H24F3IN6 — CID 109379113
N-ethyl-N'-(1H-pyrazol-5-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379113) has the molecular formula C14H24F3IN6 and a molecular weight of 460.29 g/mol. Its IUPAC name is N-ethyl-N'-(1H-pyrazol-5-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-(1H-pyrazol-5-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379113 |
| Molecular Formula | C14H24F3IN6 |
| Molecular Weight | 460.29 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-ethyl-N'-(1H-pyrazol-5-ylmethyl)-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C14H23F3N6.HI/c1-3-18-13(19-10-12-4-5-20-21-12)23-8-6-22(7-9-23)11(2)14(15,16)17;/h4-5,11H,3,6-10H2,1-2H3,(H,18,19)(H,20,21);1H |
| InChIKey | FUGSFMQEZUCGMT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|