C18H26F6IN5O — CID 109379179
N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 109379179) has the molecular formula C18H26F6IN5O and a molecular weight of 569.33 g/mol. Its IUPAC name is N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109379179 |
| Molecular Formula | C18H26F6IN5O |
| Molecular Weight | 569.33 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | N-ethyl-N'-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C18H25F6N5O.HI/c1-3-25-16(29-8-6-28(7-9-29)13(2)18(22,23)24)27-11-14-4-5-26-15(10-14)30-12-17(19,20)21;/h4-5,10,13H,3,6-9,11-12H2,1-2H3,(H,25,27);1H |
| InChIKey | KDAWHSHPGHNIOX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|