C21H34F3N5O2 — CID 111935289
1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111935289) has the molecular formula C21H34F3N5O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111935289 |
| Molecular Formula | C21H34F3N5O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 1-ethyl-3-(4-methyl-2-morpholin-4-ylpentyl)-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C21H34F3N5O2/c1-4-25-20(28-14-18(11-16(2)3)29-7-9-30-10-8-29)27-13-17-5-6-26-19(12-17)31-15-21(22,23)24/h5-6,12,16,18H,4,7-11,13-15H2,1-3H3,(H2,25,27,28) |
| InChIKey | IVPGAXGCMSSUTK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|