C19H31F3N4O2 — CID 111715821
1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111715821) has the molecular formula C19H31F3N4O2 and a molecular weight of 404.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111715821 |
| Molecular Formula | C19H31F3N4O2 |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | 1-ethyl-3-[2-(2-hydroxyethyl)-4-methylpentyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCC(CCO)CC(C)C |
| InChI | InChI=1S/C19H31F3N4O2/c1-4-23-18(26-12-16(6-8-27)9-14(2)3)25-11-15-5-7-24-17(10-15)28-13-19(20,21)22/h5,7,10,14,16,27H,4,6,8-9,11-13H2,1-3H3,(H2,23,25,26) |
| InChIKey | KGRJRNVEZPRXPC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|