C21H27F3N4O3 — CID 111683576
1-ethyl-3-[2-(2-methoxyphenoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine (PubChem CID 111683576) has the molecular formula C21H27F3N4O3 and a molecular weight of 440.47 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-methoxyphenoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(2-methoxyphenoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111683576 |
| Molecular Formula | C21H27F3N4O3 |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1-ethyl-3-[2-(2-methoxyphenoxy)propyl]-2-[[2-(2,2,2-trifluoroethoxy)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccnc(OCC(F)(F)F)c1)NCC(C)Oc1ccccc1OC |
| InChI | InChI=1S/C21H27F3N4O3/c1-4-25-20(27-12-15(2)31-18-8-6-5-7-17(18)29-3)28-13-16-9-10-26-19(11-16)30-14-21(22,23)24/h5-11,15H,4,12-14H2,1-3H3,(H2,25,27,28) |
| InChIKey | FWXJMELPBQQWHG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|