C18H30FN3O — CID 111714656
1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111714656) has the molecular formula C18H30FN3O and a molecular weight of 323.46 g/mol. Its IUPAC name is 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111714656 |
| Molecular Formula | C18H30FN3O |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | 1-ethyl-2-[(3-fluorophenyl)methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(F)c1)NCC(CCO)CC(C)C |
| InChI | InChI=1S/C18H30FN3O/c1-4-20-18(21-12-15-6-5-7-17(19)11-15)22-13-16(8-9-23)10-14(2)3/h5-7,11,14,16,23H,4,8-10,12-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | AUOKJQUUYNLNPB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|