C22H40N4O — CID 111714623
1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine (PubChem CID 111714623) has the molecular formula C22H40N4O and a molecular weight of 376.59 g/mol. Its IUPAC name is 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine.
| Compound Name | 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
|---|---|
| PubChem CID | 111714623 |
| Molecular Formula | C22H40N4O |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.32 |
| IUPAC Name | 1-ethyl-2-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-3-[2-(2-hydroxyethyl)-4-methylpentyl]guanidine |
| SMILES | CCN/C(=N\Cc1cccc(CN(C)CC)c1)NCC(CCO)CC(C)C |
| InChI | InChI=1S/C22H40N4O/c1-6-23-22(25-16-20(11-12-27)13-18(3)4)24-15-19-9-8-10-21(14-19)17-26(5)7-2/h8-10,14,18,20,27H,6-7,11-13,15-17H2,1-5H3,(H2,23,24,25) |
| InChIKey | QCETYGCXLOSHAI-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|