C20H30F3IN4O3 — CID 109377662
methyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide (PubChem CID 109377662) has the molecular formula C20H30F3IN4O3 and a molecular weight of 558.38 g/mol. Its IUPAC name is methyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide.
| Compound Name | methyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
|---|---|
| PubChem CID | 109377662 |
| Molecular Formula | C20H30F3IN4O3 |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | methyl 4-[[[ethylamino-[4-(1,1,1-trifluoropropan-2-yl)piperazin-1-yl]methylidene]amino]methyl]-2-methoxybenzoate;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C(=O)OC)c(OC)c1)N1CCN(C(C)C(F)(F)F)CC1.I |
| InChI | InChI=1S/C20H29F3N4O3.HI/c1-5-24-19(27-10-8-26(9-11-27)14(2)20(21,22)23)25-13-15-6-7-16(18(28)30-4)17(12-15)29-3;/h6-7,12,14H,5,8-11,13H2,1-4H3,(H,24,25);1H |
| InChIKey | XOOBONZIUVEYDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|