C21H33F3N4O3 — CID 109377803
N'-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide (PubChem CID 109377803) has the molecular formula C21H33F3N4O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is N'-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 109377803 |
| Molecular Formula | C21H33F3N4O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | N'-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-N-ethyl-4-(1,1,1-trifluoropropan-2-yl)piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OCC)c(OC)c1)N1CCN(C(C)C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H33F3N4O3/c1-6-25-20(28-10-8-27(9-11-28)15(3)21(22,23)24)26-14-16-12-17(29-4)19(31-7-2)18(13-16)30-5/h12-13,15H,6-11,14H2,1-5H3,(H,25,26) |
| InChIKey | OBBCIGPTPSAABQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|