C21H30ClIN6O2 — CID 111207715
N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111207715) has the molecular formula C21H30ClIN6O2 and a molecular weight of 560.87 g/mol. Its IUPAC name is N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111207715 |
| Molecular Formula | C21H30ClIN6O2 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | N'-[(3-chloro-4-ethoxy-5-methoxyphenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(Cl)c(OCC)c(OC)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C21H29ClN6O2.HI/c1-4-23-20(27-9-11-28(12-10-27)21-24-7-6-8-25-21)26-15-16-13-17(22)19(30-5-2)18(14-16)29-3;/h6-8,13-14H,4-5,9-12,15H2,1-3H3,(H,23,26);1H |
| InChIKey | OJFMZUWRJWFMMM-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|