C18H23ClN6 — CID 111207960
N'-[(4-chlorophenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111207960) has the molecular formula C18H23ClN6 and a molecular weight of 358.88 g/mol. Its IUPAC name is N'-[(4-chlorophenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(4-chlorophenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111207960 |
| Molecular Formula | C18H23ClN6 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N'-[(4-chlorophenyl)methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C18H23ClN6/c1-2-20-17(23-14-15-4-6-16(19)7-5-15)24-10-12-25(13-11-24)18-21-8-3-9-22-18/h3-9H,2,10-14H2,1H3,(H,20,23) |
| InChIKey | RZUVHVJRXPDJBK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|