C19H26FIN6 — CID 111205295
N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111205295) has the molecular formula C19H26FIN6 and a molecular weight of 484.36 g/mol. Its IUPAC name is N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111205295 |
| Molecular Formula | C19H26FIN6 |
| Molecular Weight | 484.36 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | N-ethyl-N'-[(3-fluoro-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(F)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C19H25FN6.HI/c1-3-21-18(24-14-16-6-5-15(2)17(20)13-16)25-9-11-26(12-10-25)19-22-7-4-8-23-19;/h4-8,13H,3,9-12,14H2,1-2H3,(H,21,24);1H |
| InChIKey | TWMDHURKCGJCST-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|