C20H29IN6O — CID 111205419
N-ethyl-N'-[(3-methoxy-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111205419) has the molecular formula C20H29IN6O and a molecular weight of 496.40 g/mol. Its IUPAC name is N-ethyl-N'-[(3-methoxy-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[(3-methoxy-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111205419 |
| Molecular Formula | C20H29IN6O |
| Molecular Weight | 496.40 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | N-ethyl-N'-[(3-methoxy-4-methylphenyl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(C)c(OC)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C20H28N6O.HI/c1-4-21-19(24-15-17-7-6-16(2)18(14-17)27-3)25-10-12-26(13-11-25)20-22-8-5-9-23-20;/h5-9,14H,4,10-13,15H2,1-3H3,(H,21,24);1H |
| InChIKey | XETFUHHWHLLWJV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|