C23H36IN7 — CID 111207733
N'-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111207733) has the molecular formula C23H36IN7 and a molecular weight of 537.49 g/mol. Its IUPAC name is N'-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111207733 |
| Molecular Formula | C23H36IN7 |
| Molecular Weight | 537.49 g/mol |
| Exact Mass | 537.21 |
| IUPAC Name | N'-[[4-(diethylaminomethyl)phenyl]methyl]-N-ethyl-4-pyrimidin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(CN(CC)CC)cc1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H35N7.HI/c1-4-24-22(29-14-16-30(17-15-29)23-25-12-7-13-26-23)27-18-20-8-10-21(11-9-20)19-28(5-2)6-3;/h7-13H,4-6,14-19H2,1-3H3,(H,24,27);1H |
| InChIKey | UHLVHHNSNJZCRP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.49 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|