C22H33N7 — CID 111206794
N-ethyl-N'-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 111206794) has the molecular formula C22H33N7 and a molecular weight of 395.56 g/mol. Its IUPAC name is N-ethyl-N'-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111206794 |
| Molecular Formula | C22H33N7 |
| Molecular Weight | 395.56 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-ethyl-N'-[[3-[[ethyl(methyl)amino]methyl]phenyl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1cccc(CN(C)CC)c1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H33N7/c1-4-23-21(26-17-19-8-6-9-20(16-19)18-27(3)5-2)28-12-14-29(15-13-28)22-24-10-7-11-25-22/h6-11,16H,4-5,12-15,17-18H2,1-3H3,(H,23,26) |
| InChIKey | IXDYSMMXEUOKSB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.56 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|