C23H35IN8O — CID 111207905
N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide (PubChem CID 111207905) has the molecular formula C23H35IN8O and a molecular weight of 566.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
|---|---|
| PubChem CID | 111207905 |
| Molecular Formula | C23H35IN8O |
| Molecular Weight | 566.49 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]benzamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(C(=O)NCCN(C)C)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C23H34N8O.HI/c1-4-24-22(30-13-15-31(16-14-30)23-26-9-6-10-27-23)28-18-19-7-5-8-20(17-19)21(32)25-11-12-29(2)3;/h5-10,17H,4,11-16,18H2,1-3H3,(H,24,28)(H,25,32);1H |
| InChIKey | NGGYXFTXFGBJAW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|