C20H28IN7O2 — CID 111983900
2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111983900) has the molecular formula C20H28IN7O2 and a molecular weight of 525.40 g/mol. Its IUPAC name is 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111983900 |
| Molecular Formula | C20H28IN7O2 |
| Molecular Weight | 525.40 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | 2-[3-[[[ethylamino-(4-pyrimidin-2-ylpiperazin-1-yl)methylidene]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCC(N)=O)c1)N1CCN(c2ncccn2)CC1.I |
| InChI | InChI=1S/C20H27N7O2.HI/c1-2-22-19(25-14-16-5-3-6-17(13-16)29-15-18(21)28)26-9-11-27(12-10-26)20-23-7-4-8-24-20;/h3-8,13H,2,9-12,14-15H2,1H3,(H2,21,28)(H,22,25);1H |
| InChIKey | LAGHOCVPPOEUHL-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 108.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|