C22H32IN5O2 — CID 111219476
N-ethyl-N'-[[3-(2-methoxyethoxy)phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111219476) has the molecular formula C22H32IN5O2 and a molecular weight of 525.44 g/mol. Its IUPAC name is N-ethyl-N'-[[3-(2-methoxyethoxy)phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[[3-(2-methoxyethoxy)phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111219476 |
| Molecular Formula | C22H32IN5O2 |
| Molecular Weight | 525.44 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | N-ethyl-N'-[[3-(2-methoxyethoxy)phenyl]methyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OCCOC)c1)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C22H31N5O2.HI/c1-3-23-22(25-18-19-7-6-8-20(17-19)29-16-15-28-2)27-13-11-26(12-14-27)21-9-4-5-10-24-21;/h4-10,17H,3,11-16,18H2,1-2H3,(H,23,25);1H |
| InChIKey | CJVOJUYEPDXQIN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|