C22H32IN5O — CID 111221054
N-ethyl-N'-[3-(3-methoxyphenyl)propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111221054) has the molecular formula C22H32IN5O and a molecular weight of 509.44 g/mol. Its IUPAC name is N-ethyl-N'-[3-(3-methoxyphenyl)propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-ethyl-N'-[3-(3-methoxyphenyl)propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111221054 |
| Molecular Formula | C22H32IN5O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | N-ethyl-N'-[3-(3-methoxyphenyl)propyl]-4-pyridin-2-ylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCN/C(=N\CCCc1cccc(OC)c1)N1CCN(c2ccccn2)CC1.I |
| InChI | InChI=1S/C22H31N5O.HI/c1-3-23-22(25-13-7-9-19-8-6-10-20(18-19)28-2)27-16-14-26(15-17-27)21-11-4-5-12-24-21;/h4-6,8,10-12,18H,3,7,9,13-17H2,1-2H3,(H,23,25);1H |
| InChIKey | YHTMVAYCHKIBBY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|